For research use only. Not for therapeutic Use.
TRANS-1-AMINO-2-INDANOL (Cat. No: M099696) is a heterocyclic compound that can be used as a pharmaceutical intermediate in the preparation of chemical raw materials, mainly for scientific research.
| CAS Number | 140632-19-5 |
| Synonyms | TRANS-1-AMINO-2-INDANOL |
| Molecular Formula | C9H11NO |
| Purity | ≥95% |
| Storage | -80°C |
| IUPAC Name | (1R,2R)-1-amino-2,3-dihydro-1H-inden-2-ol |
| InChI | InChI=1S/C9H11NO/c10-9-7-4-2-1-3-6(7)5-8(9)11/h1-4,8-9,11H,5,10H2/t8-,9-/m1/s1 |
| InChIKey | LOPKSXMQWBYUOI-RKDXNWHRSA-N |
| SMILES | C1C(C(C2=CC=CC=C21)N)O |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |