For research use only. Not for therapeutic Use.
TPBM (Cat No.:I037433) is a boron-based compound often used in organic synthesis and material science. It is known for its ability to act as a Lewis acid, facilitating various chemical reactions, particularly in catalysis and polymerization processes. TPBM can also be used in the development of functional materials such as organic semiconductors and light-emitting diodes (LEDs). Additionally, its unique electronic properties make it a valuable tool in research related to organoboron chemistry, with potential applications in electronics, energy storage, and optoelectronic devices. Further studies explore its use in catalysis and materials innovation.
| CAS Number | 6466-43-9 |
| Synonyms | 8-(benzylsulfanylmethyl)-1,3-dimethyl-7H-purine-2,6-dione |
| Molecular Formula | C15H16N4O2S |
| Purity | ≥95% |
| IUPAC Name | 8-(benzylsulfanylmethyl)-1,3-dimethyl-7H-purine-2,6-dione |
| InChI | InChI=1S/C15H16N4O2S/c1-18-13-12(14(20)19(2)15(18)21)16-11(17-13)9-22-8-10-6-4-3-5-7-10/h3-7H,8-9H2,1-2H3,(H,16,17) |
| InChIKey | FEHAMBYTUPDFJE-UHFFFAOYSA-N |
| SMILES | CN1C2=C(C(=O)N(C1=O)C)NC(=N2)CSCC3=CC=CC=C3 |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |
