For research use only. Not for therapeutic Use.
Tosylmethyl Isocyanide-13C1 is an isotopically labeled form of Tosylmethyl Isocyanide, featuring one carbon-13 (13C) atom. This high-purity compound is particularly valuable in organic synthesis, especially in the preparation of isocyanide-based multicomponent reactions, such as the Ugi reaction. The 13C labeling allows for enhanced tracking and analysis in NMR spectroscopy and mass spectrometry, making it a critical tool for researchers studying reaction mechanisms, structural elucidation, and the behavior of isocyanide derivatives in various synthetic pathways. Tosylmethyl Isocyanide-13C1 is an essential reagent for chemists involved in the development of complex molecules and the exploration of novel synthetic methodologies.
CAS Number | 60684-36-8 |
Synonyms | 1-[(Isocyanomethyl)sulfonyl]-4-methylbenzene-13C1; (4-Methylphenylsulfonyl)methyl Isocyanide-13C1; (p-Tolylsulfonyl)methyl isocyanide-13C1; 4-Toluenesulfonylmethyl Isocyanide-13C1; 4-Tolylsulfonylmethyl Isocyanide-13C1; Isocyanomethyl p-Tolyl Sulfone |
Molecular Formula | C9H9NO2S |
Purity | ≥95% |
Storage | -20°C |
IUPAC Name | 1-methyl-4-(methylidyneazaniumylmethylsulfonyl)benzene |
InChI | InChI=1S/C9H9NO2S/c1-8-3-5-9(6-4-8)13(11,12)7-10-2/h3-6H,7H2,1H3/i2+1 |
InChIKey | CFOAUYCPAUGDFF-VQEHIDDOSA-N |
SMILES | CC1=CC=C(C=C1)S(=O)(=O)C[N+]#[C-] |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |