For research use only. Not for therapeutic Use.
Torilin(CAT: R060228) is a sesquiterpene compound isolated from the plant Torilis japonica. It has gained attention for its potential pharmacological properties, particularly its anti-inflammatory, anticancer, and antiangiogenic effects. Torilin has been studied for its ability to inhibit the growth of certain cancer cells and suppress angiogenesis by targeting vascular endothelial growth factor (VEGF). Additionally, it shows promise as a therapeutic agent for treating inflammatory conditions due to its capacity to modulate key inflammatory pathways. Torilin’s diverse biological activities make it a valuable compound in natural product research and drug discovery, particularly in cancer and inflammation-related studies.
CAS Number | 13018-10-5 |
Molecular Formula | C22H32O5 |
Purity | ≥95% |
Storage | -20°C |
IUPAC Name | [(5S,6R,8S,8aR)-5-(2-acetyloxypropan-2-yl)-3,8-dimethyl-2-oxo-4,5,6,7,8,8a-hexahydro-1H-azulen-6-yl] (Z)-2-methylbut-2-enoate |
InChI | InChI=1S/C22H32O5/c1-8-12(2)21(25)26-20-9-13(3)16-11-19(24)14(4)17(16)10-18(20)22(6,7)27-15(5)23/h8,13,16,18,20H,9-11H2,1-7H3/b12-8-/t13-,16+,18-,20+/m0/s1 |
InChIKey | IQWVFAXBJQKUDH-TXCQZRSTSA-N |
SMILES | CC=C(C)C(=O)OC1CC(C2CC(=O)C(=C2CC1C(C)(C)OC(=O)C)C)C |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |