For research use only. Not for therapeutic Use.
Toralactone（Cat No.:I044901）is a naturally occurring coumarin derivative primarily isolated from plants in the Angelica and Ferula genera. Known for its aromatic lactone structure, toralactone exhibits a range of pharmacological effects, including antioxidant, anti-inflammatory, and antimicrobial activities. It is of interest in phytochemical and pharmacognostic studies due to its potential to modulate oxidative stress and inhibit pro-inflammatory mediators. Toralactone’s structural features also make it a useful lead compound in drug development. Its presence in traditional medicinal herbs underscores its role in natural therapies for inflammation-related disorders.
| CAS Number | 41743-74-2 |
| Synonyms | 1,10-dihydroxy-7-methoxy-3-methylbenzo[g]isochromen-9-one |
| Molecular Formula | C15H12O5 |
| Purity | ≥95% |
| IUPAC Name | 9,10-dihydroxy-7-methoxy-3-methylbenzo[g]isochromen-1-one |
| InChI | InChI=1S/C15H12O5/c1-7-3-8-4-9-5-10(19-2)6-11(16)12(9)14(17)13(8)15(18)20-7/h3-6,16-17H,1-2H3 |
| InChIKey | WEHXAEGTVPWKDY-UHFFFAOYSA-N |
| SMILES | CC1=CC2=CC3=CC(=CC(=C3C(=C2C(=O)O1)O)O)OC |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |
