For research use only. Not for therapeutic Use.
Torachrysone-8-O-β-D-glucoside（Cat No.:R063713）is a naturally occurring anthraquinone glycoside isolated from traditional medicinal plants such as Fallopia japonica and Polygonum cuspidatum. It exhibits notable antioxidant, anti-inflammatory, and cytoprotective properties. As a glycosylated derivative of torachrysone, it plays a role in modulating oxidative stress pathways and may contribute to the therapeutic effects of herbal extracts used in liver protection, cardiovascular support, and anti-aging research. Torachrysone-8-O-β-D-glucoside is frequently explored in pharmacognosy and natural product chemistry for its potential in drug discovery.
| CAS Number | 64032-49-1 |
| Synonyms | 1-[1-hydroxy-6-methoxy-3-methyl-8-[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxynaphthalen-2-yl]ethanone |
| Molecular Formula | C20H24O9 |
| Purity | ≥95% |
| IUPAC Name | 1-[1-hydroxy-6-methoxy-3-methyl-8-[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxynaphthalen-2-yl]ethanone |
| InChI | InChI=1S/C20H24O9/c1-8-4-10-5-11(27-3)6-12(15(10)17(24)14(8)9(2)22)28-20-19(26)18(25)16(23)13(7-21)29-20/h4-6,13,16,18-21,23-26H,7H2,1-3H3 |
| InChIKey | GHKWPHRULCFTBB-UHFFFAOYSA-N |
| SMILES | CC1=CC2=CC(=CC(=C2C(=C1C(=O)C)O)OC3C(C(C(C(O3)CO)O)O)O)OC |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |
