For research use only. Not for therapeutic Use.
Topsentin A(Cat No.:M026790) is a bioactive compound isolated from marine sponges, particularly those belonging to the genus Topsentia. It is part of a family of brominated bis-indole alkaloids, known for their complex structures and potent biological activities. Topsentin A has attracted interest due to its anticancer properties, exhibiting cytotoxic activity against various cancer cell lines. The mechanism by which it exerts its effects typically involves the disruption of microtubule dynamics, which is crucial for cell division. This makes Topsentin A a candidate for further pharmaceutical research and potential drug development targeting cancer therapies.
| CAS Number | 112515-42-1 |
| Molecular Formula | C20H14N4O |
| Purity | ≥95% |
| Storage | Desiccate at +4C |
| IUPAC Name | 1H-indol-3-yl-[5-(1H-indol-3-yl)-1H-imidazol-2-yl]methanone |
| InChI | InChI=1S/C20H14N4O/c25-19(15-10-22-17-8-4-2-6-13(15)17)20-23-11-18(24-20)14-9-21-16-7-3-1-5-12(14)16/h1-11,21-22H,(H,23,24) |
| InChIKey | OBDUUEITYHUFCW-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C(=CN2)C3=CN=C(N3)C(=O)C4=CNC5=CC=CC=C54 |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |