For research use only. Not for therapeutic Use.
Tolmetin（Cat No.:I045017）is a nonsteroidal anti-inflammatory drug (NSAID) used to relieve pain and inflammation associated with conditions like rheumatoid arthritis, osteoarthritis, and juvenile arthritis. It works by inhibiting cyclooxygenase (COX) enzymes, reducing the synthesis of prostaglandins involved in inflammation, pain, and fever. Tolmetin offers a relatively rapid onset of action and is generally well-absorbed after oral administration. While effective, it may cause gastrointestinal irritation or other NSAID-related side effects. Due to its anti-inflammatory and analgesic properties, tolmetin is a useful option for managing chronic musculoskeletal and joint disorders.
| CAS Number | 26171-23-3 |
| Synonyms | 2-[1-methyl-5-(4-methylbenzoyl)pyrrol-2-yl]acetic acid |
| Molecular Formula | C15H15NO3 |
| Purity | ≥95% |
| IUPAC Name | 2-[1-methyl-5-(4-methylbenzoyl)pyrrol-2-yl]acetic acid |
| InChI | InChI=1S/C15H15NO3/c1-10-3-5-11(6-4-10)15(19)13-8-7-12(16(13)2)9-14(17)18/h3-8H,9H2,1-2H3,(H,17,18) |
| InChIKey | UPSPUYADGBWSHF-UHFFFAOYSA-N |
| SMILES | CC1=CC=C(C=C1)C(=O)C2=CC=C(N2C)CC(=O)O |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |
