For research use only. Not for therapeutic Use.
TNIK-IN-5（Cat No.:I043914）is a potent and selective inhibitor targeting the TNIK (TRAF2 and NCK-interacting kinase) enzyme, which plays a crucial role in the Wnt/β-catenin signaling pathway. By inhibiting TNIK, this compound modulates cellular processes involved in cancer cell proliferation, survival, and migration. TNIK-IN-5 shows promising potential in cancer research, particularly in tumors with aberrant Wnt signaling. Its specificity and effectiveness make it a valuable tool for studying the mechanistic role of TNIK in oncogenesis and for developing therapeutic strategies targeting TNIK-driven cancers.
| CAS Number | 2754265-66-0 |
| Synonyms | 3-[(3-methoxyphenyl)methyl]-6-(1H-pyrrolo[2,3-b]pyridin-5-yl)-1,3-benzoxazol-2-one |
| Molecular Formula | C22H17N3O3 |
| Purity | ≥95% |
| IUPAC Name | 3-[(3-methoxyphenyl)methyl]-6-(1H-pyrrolo[2,3-b]pyridin-5-yl)-1,3-benzoxazol-2-one |
| InChI | InChI=1S/C22H17N3O3/c1-27-18-4-2-3-14(9-18)13-25-19-6-5-15(11-20(19)28-22(25)26)17-10-16-7-8-23-21(16)24-12-17/h2-12H,13H2,1H3,(H,23,24) |
| InChIKey | DRHILHIKLGEWOH-UHFFFAOYSA-N |
| SMILES | COC1=CC=CC(=C1)CN2C3=C(C=C(C=C3)C4=CN=C5C(=C4)C=CN5)OC2=O |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |
