For research use only. Not for therapeutic Use.
TN-16（Cat No.:R066940）is a microtubule-disrupting agent that inhibits tubulin polymerization, leading to cell cycle arrest and apoptosis. It exhibits potent antimitotic activity by interfering with microtubule dynamics, crucial for mitotic spindle formation. TN-16 has demonstrated anticancer potential in various preclinical models by impairing tumor cell proliferation. Additionally, it induces autophagy and modulates cellular stress responses, making it a valuable tool in cancer biology research. Researchers utilize TN-16 to study microtubule-targeting mechanisms, drug resistance, and combination therapies in oncology and cell division-related disorders.
| CAS Number | 33016-12-5 |
| Synonyms | 2-benzyl-3-hydroxy-4-(C-methyl-N-phenylcarbonimidoyl)-1,2-dihydropyrrol-5-one |
| Molecular Formula | C19H18N2O2 |
| Purity | ≥95% |
| IUPAC Name | 2-benzyl-3-hydroxy-4-(C-methyl-N-phenylcarbonimidoyl)-1,2-dihydropyrrol-5-one |
| InChI | InChI=1S/C19H18N2O2/c1-13(20-15-10-6-3-7-11-15)17-18(22)16(21-19(17)23)12-14-8-4-2-5-9-14/h2-11,16,22H,12H2,1H3,(H,21,23) |
| InChIKey | IHXKJZIDPGITHW-UHFFFAOYSA-N |
| SMILES | CC(=NC1=CC=CC=C1)C2=C(C(NC2=O)CC3=CC=CC=C3)O |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |
