For research use only. Not for therapeutic Use.
TM6089（Cat No.:I012165）is a small-molecule inhibitor of heat shock protein 90 (HSP90), a molecular chaperone essential for the stability and function of numerous oncogenic client proteins. By blocking HSP90 activity, TM6089 induces proteasomal degradation of its client proteins, leading to suppression of tumor cell growth and survival. Preclinical studies highlight its potential in cancer research, particularly in targeting pathways related to proliferation, angiogenesis, and metastasis. TM6089 is a valuable experimental tool for investigating chaperone biology, oncogenic signaling networks, and therapeutic approaches in oncology and molecular pharmacology.
| CAS Number | 863421-32-3 |
| Synonyms | 6-amino-1,3-dimethyl-5-(2-pyridin-2-ylsulfanylacetyl)pyrimidine-2,4-dione |
| Molecular Formula | C13H14N4O3S |
| Purity | ≥95% |
| IUPAC Name | 6-amino-1,3-dimethyl-5-(2-pyridin-2-ylsulfanylacetyl)pyrimidine-2,4-dione |
| InChI | InChI=1S/C13H14N4O3S/c1-16-11(14)10(12(19)17(2)13(16)20)8(18)7-21-9-5-3-4-6-15-9/h3-6H,7,14H2,1-2H3 |
| InChIKey | UWXHGWIWBWQJNU-UHFFFAOYSA-N |
| SMILES | CN1C(=C(C(=O)N(C1=O)C)C(=O)CSC2=CC=CC=N2)N |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |
