For research use only. Not for therapeutic Use.
TL8-506(Cat No.:I043822)is a selective inhibitor targeting the TL8 protein, which plays a key role in regulating immune responses and inflammatory processes. By modulating the activity of TL8, this compound has potential therapeutic applications in autoimmune diseases and chronic inflammatory conditions. TL8-506 works by inhibiting TL8’s function, which helps reduce excessive immune activation and inflammation. Its specificity and effectiveness make it a promising candidate for research into novel treatments for diseases driven by dysregulated immune responses, offering new hope for managing conditions like rheumatoid arthritis and multiple sclerosis.
| CAS Number | 1268163-15-0 |
| Synonyms | ethyl 2-amino-8-(3-cyanophenyl)-3H-1-benzazepine-4-carboxylate |
| Molecular Formula | C20H17N3O2 |
| Purity | ≥95% |
| IUPAC Name | ethyl 2-amino-8-(3-cyanophenyl)-3H-1-benzazepine-4-carboxylate |
| InChI | InChI=1S/C20H17N3O2/c1-2-25-20(24)17-9-16-7-6-15(10-18(16)23-19(22)11-17)14-5-3-4-13(8-14)12-21/h3-10H,2,11H2,1H3,(H2,22,23) |
| InChIKey | YHRYTTWRVKXODS-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=CC2=C(C=C(C=C2)C3=CC=CC(=C3)C#N)N=C(C1)N |
| Reference |
|
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |