For research use only. Not for therapeutic Use.
Tirucallol（Cat No.:I037332）is a pentacyclic triterpenoid alcohol primarily isolated from plants such as Azadirachta indica (neem) and Boswellia serrata. It exhibits diverse pharmacological properties, including anti-inflammatory, antioxidant, anticancer, and hepatoprotective effects. Tirucallol modulates inflammatory responses by inhibiting mediators like nitric oxide and pro-inflammatory cytokines. It also shows cytotoxic activity against various cancer cell lines, likely through the induction of apoptosis and disruption of cell signaling pathways. With its robust triterpenoid framework, tirucallol is a promising natural compound for therapeutic development in inflammation-related disorders, liver protection, and cancer treatment.
| CAS Number | 514-46-5 |
| Synonyms | (3S,5R,10S,13S,14S,17S)-4,4,10,13,14-pentamethyl-17-[(2S)-6-methylhept-5-en-2-yl]-2,3,5,6,7,11,12,15,16,17-decahydro-1H-cyclopenta[a]phenanthren-3-ol |
| Molecular Formula | C30H50O |
| Purity | ≥95% |
| IUPAC Name | (3S,5R,10S,13S,14S,17S)-4,4,10,13,14-pentamethyl-17-[(2S)-6-methylhept-5-en-2-yl]-2,3,5,6,7,11,12,15,16,17-decahydro-1H-cyclopenta[a]phenanthren-3-ol |
| InChI | InChI=1S/C30H50O/c1-20(2)10-9-11-21(3)22-14-18-30(8)24-12-13-25-27(4,5)26(31)16-17-28(25,6)23(24)15-19-29(22,30)7/h10,21-22,25-26,31H,9,11-19H2,1-8H3/t21-,22-,25-,26-,28+,29-,30+/m0/s1 |
| InChIKey | CAHGCLMLTWQZNJ-HGKXYCPESA-N |
| SMILES | C[C@@H](CCC=C(C)C)[C@@H]1CC[C@]2([C@]1(CCC3=C2CC[C@@H]4[C@@]3(CC[C@@H](C4(C)C)O)C)C)C |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |
