For research use only. Not for therapeutic Use.
Tiadinil (Cat No.:I002717) is a synthetic fungicide that belongs to the class of benzamide compounds. It is primarily used for the control of various fungal diseases in crops. Tiadinil acts by inhibiting the enzyme isoprenylcysteine carboxyl methyltransferase (ICMT), which is involved in the prenylation process of proteins. By inhibiting ICMT, tiadinil disrupts the proper function of prenylated proteins in fungal cells, leading to the inhibition of fungal growth and the prevention of disease development. It has shown effectiveness against a range of plant pathogenic fungi, making it valuable for crop protection. Tiadinil is typically applied as a foliar spray or seed treatment in agricultural practices.
| CAS Number | 223580-51-6 |
| Molecular Formula | C11H10ClN3OS |
| Purity | 95% |
| Target | Bacterial |
| Solubility | 10 mM in DMSO |
| Storage | Store at -20°C |
| IUPAC Name | N-(3-chloro-4-methylphenyl)-4-methylthiadiazole-5-carboxamide |
| InChI | InChI=1S/C11H10ClN3OS/c1-6-3-4-8(5-9(6)12)13-11(16)10-7(2)14-15-17-10/h3-5H,1-2H3,(H,13,16) |
| InChIKey | VJQYLJSMBWXGDV-UHFFFAOYSA-N |
| SMILES | CC1=C(SN=N1)C(=O)NC1=CC=C(C)C(Cl)=C1 |
| Reference | <p style=”/line-height:25px/”> |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |