For research use only. Not for therapeutic Use.
TI17(CAT: I040365) is a small-molecule inhibitor targeting the thyroid hormone receptor-interacting protein Trip13, an AAA-ATPase involved in double-strand break (DSB) repair and chromosome stability. By disrupting Trip13 function, TI17 induces DNA damage accumulation, leading to cell cycle arrest and apoptosis. This compound demonstrates potent anticancer activity, particularly against multiple myeloma (MM) cells, where it effectively inhibits proliferation. TI17 is a valuable tool for probing the mechanistic role of Trip13 in genomic maintenance and mitotic progression. It supports cancer research focused on DNA repair vulnerabilities and offers promising therapeutic potential for malignancies reliant on Trip13-mediated repair pathways.
| CAS Number | 1005178-02-8 |
| Synonyms | 7-[[4-(pyridin-4-ylmethyl)phenyl]carbamoyl]tricyclo[3.2.2.02,4]non-8-ene-6-carboxylic acid |
| Molecular Formula | C23H22N2O3 |
| Purity | ≥95% |
| IUPAC Name | 7-[[4-(pyridin-4-ylmethyl)phenyl]carbamoyl]tricyclo[3.2.2.02,4]non-8-ene-6-carboxylic acid |
| InChI | InChI=1S/C23H22N2O3/c26-22(20-16-5-6-17(19-12-18(16)19)21(20)23(27)28)25-15-3-1-13(2-4-15)11-14-7-9-24-10-8-14/h1-10,16-21H,11-12H2,(H,25,26)(H,27,28) |
| InChIKey | FTGODPNMSWLLKK-UHFFFAOYSA-N |
| SMILES | C1C2C1C3C=CC2C(C3C(=O)O)C(=O)NC4=CC=C(C=C4)CC5=CC=NC=C5 |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |
