For research use only. Not for therapeutic Use.
Thymine（Cat No.:R055795）is a naturally occurring pyrimidine nucleobase, essential for the structure and function of DNA. It pairs specifically with adenine via two hydrogen bonds, contributing to the stability and fidelity of the genetic code. As a fundamental component of deoxyribonucleotides, thymine plays a crucial role in DNA replication, repair, and transcription regulation. It is widely used in molecular biology, genetic engineering, and biochemical research. High-purity thymine supports studies in nucleic acid chemistry, drug development, and the design of nucleotide-based therapeutics and diagnostics.
| CAS Number | 65-71-4 |
| Synonyms | 5-Methyl-2,4(1H,3H)-pyrimidinedione; NSC 14705; NSC 1686634; 4-Hydroxy-5-methylyrimidin-2(1H)-one; 5-Methyluracil; USP Zidovudine Related Compound C; |
| Molecular Formula | C5H6N2O2 |
| Purity | ≥95% |
| Storage | -20°C |
| IUPAC Name | 5-methyl-1H-pyrimidine-2,4-dione |
| InChI | InChI=1S/C5H6N2O2/c1-3-2-6-5(9)7-4(3)8/h2H,1H3,(H2,6,7,8,9) |
| InChIKey | RWQNBRDOKXIBIV-UHFFFAOYSA-N |
| SMILES | CC1=CNC(=O)NC1=O |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |
