For research use only. Not for therapeutic Use.
Thiomorpholine 1,1-dioxide（Cat No.:L035759）, also known as tetrahydro-1,1-dioxo-1λ⁶-thiomorpholine or sulfolane, is a six-membered heterocyclic compound containing sulfur and nitrogen atoms, with the sulfur oxidized to a sulfone group. This structure imparts high polarity, chemical stability, and good solubility in both polar and nonpolar solvents. Thiomorpholine 1,1-dioxide is commonly used as a polar aprotic solvent in organic synthesis, particularly in high-pressure hydrogenation and polymer chemistry. It is also investigated as a building block in medicinal chemistry due to its metabolic stability and ability to act as a bioisostere of other nitrogen-sulfur motifs in drug design.
| CAS Number | 39093-93-1 |
| Molecular Formula | C4H9NO2S |
| Purity | ≥95% |
| IUPAC Name | 1,4-thiazinane 1,1-dioxide |
| InChI | InChI=1S/C4H9NO2S/c6-8(7)3-1-5-2-4-8/h5H,1-4H2 |
| InChIKey | NDOVLWQBFFJETK-UHFFFAOYSA-N |
| SMILES | C1CS(=O)(=O)CCN1 |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |
