For research use only. Not for therapeutic Use.
Thiol-PEG3-acid（Cat No.:I016147）is a versatile heterobifunctional linker designed for efficient bioconjugation and targeted modifications. It features a reactive thiol group that couples selectively with maleimides, haloacetyls, or disulfides, enabling stable thioether or cleavable disulfide linkages. The terminal carboxylic acid allows conjugation with amines through amide bond formation, broadening functionalization options. The PEG3 spacer enhances solubility, reduces steric hindrance, and adds flexibility, ensuring efficient reactions in complex biological systems. This reagent is widely applied in drug delivery, chemical biology, antibody–drug conjugates, and polymer–biomolecule conjugation for multifunctional assembly.
| CAS Number | 1347750-82-6 |
| Synonyms | 3-[2-[2-(2-sulfanylethoxy)ethoxy]ethoxy]propanoic acid |
| Molecular Formula | C9H18O5S |
| Purity | ≥95% |
| IUPAC Name | 3-[2-[2-(2-sulfanylethoxy)ethoxy]ethoxy]propanoic acid |
| InChI | InChI=1S/C9H18O5S/c10-9(11)1-2-12-3-4-13-5-6-14-7-8-15/h15H,1-8H2,(H,10,11) |
| InChIKey | HWTXXNAQBWZFHL-UHFFFAOYSA-N |
| SMILES | C(COCCOCCOCCS)C(=O)O |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |
