For research use only. Not for therapeutic Use.
Thiol-PEG2-acid（Cat No.:I037234）is a bifunctional polyethylene glycol (PEG) linker composed of two ethylene glycol units terminated with a thiol (-SH) group on one end and a carboxylic acid (-COOH) group on the other. This short, hydrophilic spacer provides flexibility and water solubility, making it ideal for bioconjugation applications. The thiol group enables selective attachment to maleimide- or gold-containing surfaces, while the carboxylic acid allows for amide bond formation with amines. Thiol-PEG2-acid is commonly used in drug delivery, surface modification, and the development of antibody-drug conjugates (ADCs) and nanoparticles.
| CAS Number | 1379649-73-6 |
| Synonyms | 3-[2-(2-sulfanylethoxy)ethoxy]propanoic acid |
| Molecular Formula | C7H14O4S |
| Purity | ≥95% |
| IUPAC Name | 3-[2-(2-sulfanylethoxy)ethoxy]propanoic acid |
| InChI | InChI=1S/C7H14O4S/c8-7(9)1-2-10-3-4-11-5-6-12/h12H,1-6H2,(H,8,9) |
| InChIKey | LVZZPXCJOJFHTI-UHFFFAOYSA-N |
| SMILES | C(COCCOCCS)C(=O)O |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |
