For research use only. Not for therapeutic Use.
Thiethylperazine dimaleate(Cat No.:R062294) is a phenothiazine derivative that acts as an orally active antagonist of dopamine D2 and histamine H1 receptors. Additionally, it is a selective activator of ABCC1, which reduces amyloid-β (Aβ) burden in mice. This compound exhibits antiemetic properties, making it effective in managing nausea and vomiting. Moreover, it displays antipsychotic activity and possesses antibacterial properties. The diverse pharmacological properties of Thiethylperazine dimaleate make it a valuable compound for potential therapeutic applications in various conditions, including neuropsychiatric disorders and bacterial infections.
| CAS Number | 1179-69-7 |
| Synonyms | 2-(Ethylthio)-10-[3-(4-methyl-1-piperazinyl)propyl]-10H-phenothiazine (Z)-2-Butenedioate (1:2); 2-(Ethylthio)-10-[3-(4-methyl-1-piperazinyl)propyl]phenothiazine Dimaleate; 2-(Ethylthio)-10-[3-(4-methyl-1-piperazinyl)propyl]phenothiazine Maleate (1:2) |
| Molecular Formula | C₂₂H₂₉N₃S₂•2[C₄H₄O₄] |
| Purity | ≥95% |
| Target | Neuronal Signaling |
| Storage | -20°C |
| IUPAC Name | (Z)-but-2-enedioic acid;2-ethylsulfanyl-10-[3-(4-methylpiperazin-1-yl)propyl]phenothiazine |
| InChI | InChI=1S/C22H29N3S2.2C4H4O4/c1-3-26-18-9-10-22-20(17-18)25(19-7-4-5-8-21(19)27-22)12-6-11-24-15-13-23(2)14-16-24;2*5-3(6)1-2-4(7)8/h4-5,7-10,17H,3,6,11-16H2,1-2H3;2*1-2H,(H,5,6)(H,7,8)/b;2*2-1- |
| InChIKey | RVBRTNPNFYFDMZ-SPIKMXEPSA-N |
| SMILES | CCSC1=CC2=C(C=C1)SC3=CC=CC=C3N2CCCN4CCN(CC4)C.C(=CC(=O)O)C(=O)O.C(=CC(=O)O)C(=O)O |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |