Thiamine sulfate（Cat No.:R050228）, is a water-soluble salt of thiamine, also known as Vitamin B1. It plays a crucial role in various metabolic processes in the human body, particularly in converting carbohydrates into energy and maintaining proper nerve function. Thiamine sulfate is commonly used as a dietary supplement to prevent or treat thiamine deficiency, which can lead to conditions like beriberi and Wernicke-Korsakoff syndrome. This compound is also used in some pharmaceutical formulations where thiamine supplementation is required.
| Catalog Number | R050228 |
| CAS Number | 2380-61-2 |
| Synonyms | 3-[(4-Amino-2-methyl-5-pyrimidinyl)methyl]-4-methyl-5-[2-(sulfooxy)ethyl]thiazolium Inner Salt; Thiamine Hydrogen Sulfate Ester Inner Salt; |
| Molecular Formula | C12H16N4O4S2 |
| Purity | ≥95% |
| Storage | Store at -20°C |
| IUPAC Name | 2-[3-[(4-amino-2-methylpyrimidin-5-yl)methyl]-4-methyl-1,3-thiazol-3-ium-5-yl]ethyl sulfate |
| InChI | InChI=1S/C12H16N4O4S2/c1-8-11(3-4-20-22(17,18)19)21-7-16(8)6-10-5-14-9(2)15-12(10)13/h5,7H,3-4,6H2,1-2H3,(H2-,13,14,15,17,18,19) |
| InChIKey | DXANYXRZRNXGSC-UHFFFAOYSA-N |
| SMILES | CC1=C(SC=[N+]1CC2=CN=C(N=C2N)C)CCOS(=O)(=O)[O-] |
