Theophylline-1,3-15N2-2-13C (CAT: R063868) is an isotopically labeled form of theophylline, a bronchodilator used in respiratory conditions like asthma and COPD. This labeled compound plays a pivotal role in scientific research, serving as a tracer in pharmacological and metabolic studies. By incorporating stable isotopes (13C and 15N) into its structure, researchers can investigate its metabolic pathways, pharmacokinetics, and drug metabolism within biological systems.
Catalog Number | R063868 |
CAS Number | 84718-95-6 |
Synonyms | 3,7-Dihydro-1,3-dimethyl-1H-purine-2,6-dione-2-13C-1,3-15N2 ; 3,9-Dihydro-1,3-dimethyl-1H-purine-2,6-dione-1,3-15N2-2-13C; 3,7-Dihydro-1,3-dimethyl-1H-purine-2,6-dione-1,3-15N2-2-13C; 1,3-Dimethylxanthine-1,3-15N2-2-13C; Accurbron-1,3-15N2-2-13C; Aer |
Molecular Formula | C7H8N4O2 |
Purity | 95% |
Storage | -20°C |
IUPAC Name | 1,3-dimethyl-7H-purine-2,6-dione |
InChI | InChI=1S/C7H8N4O2/c1-10-5-4(8-3-9-5)6(12)11(2)7(10)13/h3H,1-2H3,(H,8,9)/i7+1,10+1,11+1 |
InChIKey | ZFXYFBGIUFBOJW-NBLDSOAPSA-N |
SMILES | CN1C2=C(C(=O)N(C1=O)C)NC=N2 |