For research use only. Not for therapeutic Use.
Thalidomide-Propargyne-PEG3-COOH（Cat No.:I044485）is a versatile bifunctional linker designed for applications in PROTAC development and targeted protein degradation. It features a thalidomide moiety for cereblon E3 ligase recruitment, a propargyne (alkyne) group enabling click chemistry for selective conjugation, and a PEG3 (triethylene glycol) spacer that improves water solubility, reduces steric hindrance, and adds flexibility. The terminal carboxylic acid group allows for covalent attachment to amine-functionalized ligands or therapeutic agents. This well-balanced structure supports efficient and precise molecular assembly in chemical biology, aiding the development of next-generation degraders and drug delivery platforms.
| CAS Number | 2797649-54-6 |
| Synonyms | 3-[2-[2-[3-[2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindol-5-yl]prop-2-ynoxy]ethoxy]ethoxy]propanoic acid |
| Molecular Formula | C23H24N2O9 |
| Purity | ≥95% |
| IUPAC Name | 3-[2-[2-[3-[2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindol-5-yl]prop-2-ynoxy]ethoxy]ethoxy]propanoic acid |
| InChI | InChI=1S/C23H24N2O9/c26-19-6-5-18(21(29)24-19)25-22(30)16-4-3-15(14-17(16)23(25)31)2-1-8-32-10-12-34-13-11-33-9-7-20(27)28/h3-4,14,18H,5-13H2,(H,27,28)(H,24,26,29) |
| InChIKey | WWIBTSXCGDRYOX-UHFFFAOYSA-N |
| SMILES | C1CC(=O)NC(=O)C1N2C(=O)C3=C(C2=O)C=C(C=C3)C#CCOCCOCCOCCC(=O)O |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |
