For research use only. Not for therapeutic Use.
Thalidomide-Propargyne-PEG2-COOH（Cat No.:I044484）is a multifunctional linker ideal for constructing PROTACs and other targeted therapeutic agents. It includes a thalidomide unit for recruiting the cereblon E3 ligase, a propargyne (alkyne) group for bioorthogonal click chemistry, and a PEG2 (diethylene glycol) spacer that enhances solubility and molecular flexibility. The carboxylic acid terminus facilitates conjugation to amine-containing ligands or drug moieties. This linker’s modular structure enables efficient, site-specific assembly of complex molecules, supporting selective protein degradation and advanced drug design strategies in chemical biology and medicinal chemistry research.
| CAS Number | 2797619-65-7 |
| Synonyms | 3-[2-[3-[2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindol-5-yl]prop-2-ynoxy]ethoxy]propanoic acid |
| Molecular Formula | C21H20N2O8 |
| Purity | ≥95% |
| IUPAC Name | 3-[2-[3-[2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindol-5-yl]prop-2-ynoxy]ethoxy]propanoic acid |
| InChI | InChI=1S/C21H20N2O8/c24-17-6-5-16(19(27)22-17)23-20(28)14-4-3-13(12-15(14)21(23)29)2-1-8-30-10-11-31-9-7-18(25)26/h3-4,12,16H,5-11H2,(H,25,26)(H,22,24,27) |
| InChIKey | KZTYSRQJBNPAOM-UHFFFAOYSA-N |
| SMILES | C1CC(=O)NC(=O)C1N2C(=O)C3=C(C2=O)C=C(C=C3)C#CCOCCOCCC(=O)O |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |
