For research use only. Not for therapeutic Use.
Thalidomide-Piperazine-PEG1-COOH（Cat No.:I044480）is a versatile heterobifunctional linker molecule combining thalidomide, a ligand for cereblon E3 ligase recruitment, with a piperazine spacer and a short polyethylene glycol (PEG1) chain terminating in a carboxylic acid group. This structure allows for efficient conjugation to target ligands or drugs, making it highly useful in the synthesis of PROTACs and other targeted protein degradation tools. The PEG1 spacer enhances solubility and flexibility, while the carboxylic acid enables covalent attachment to amine-containing molecules, facilitating rational design in chemical biology and therapeutic development.
| CAS Number | 2731007-11-5 |
| Synonyms | 3-[2-[4-[2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindol-5-yl]piperazin-1-yl]ethoxy]propanoic acid |
| Molecular Formula | C22H26N4O7 |
| Purity | ≥95% |
| IUPAC Name | 3-[2-[4-[2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindol-5-yl]piperazin-1-yl]ethoxy]propanoic acid |
| InChI | InChI=1S/C22H26N4O7/c27-18-4-3-17(20(30)23-18)26-21(31)15-2-1-14(13-16(15)22(26)32)25-8-6-24(7-9-25)10-12-33-11-5-19(28)29/h1-2,13,17H,3-12H2,(H,28,29)(H,23,27,30) |
| InChIKey | QEXXXOMKDFNBIX-UHFFFAOYSA-N |
| SMILES | C1CC(=O)NC(=O)C1N2C(=O)C3=C(C2=O)C=C(C=C3)N4CCN(CC4)CCOCCC(=O)O |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |
