For research use only. Not for therapeutic Use.
Thalidomide-piperazine hydrochloride（Cat No.:I028469）is a modified derivative of thalidomide, which is known for its immunomodulatory and anti-inflammatory properties. The addition of piperazine enhances its solubility and bioavailability, making it a more effective compound for therapeutic applications. This compound has shown potential in the treatment of various diseases, including multiple myeloma, leprosy, and autoimmune disorders. Thalidomide-piperazine hydrochloride works by inhibiting the production of pro-inflammatory cytokines and modulating immune responses. Its ability to modulate angiogenesis and cell survival pathways also makes it a promising candidate for cancer treatment and other inflammatory conditions.
| CAS Number | 2228029-82-9 |
| Synonyms | 2-(2,6-dioxopiperidin-3-yl)-5-piperazin-1-ylisoindole-1,3-dione;hydrochloride |
| Molecular Formula | C17H19ClN4O4 |
| Purity | ≥95% |
| IUPAC Name | 2-(2,6-dioxopiperidin-3-yl)-5-piperazin-1-ylisoindole-1,3-dione;hydrochloride |
| InChI | InChI=1S/C17H18N4O4.ClH/c22-14-4-3-13(15(23)19-14)21-16(24)11-2-1-10(9-12(11)17(21)25)20-7-5-18-6-8-20;/h1-2,9,13,18H,3-8H2,(H,19,22,23);1H |
| InChIKey | GZNLORFTQXVXFE-UHFFFAOYSA-N |
| SMILES | C1CC(=O)NC(=O)C1N2C(=O)C3=C(C2=O)C=C(C=C3)N4CCNCC4.Cl |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |
