For research use only. Not for therapeutic Use.
Thalidomide-O-C8-Boc（Cat No.:I014948）is a thalidomide-based derivative designed as a building block for the synthesis of PROTACs (proteolysis-targeting chimeras) and related chemical probes. Incorporating a Boc-protected C8-alkoxy linker, it allows for selective conjugation to ligands that recruit E3 ubiquitin ligases, enabling targeted protein degradation. This compound is widely used in chemical biology and drug discovery to develop novel therapeutics that modulate undruggable targets. Its structural versatility and stability make it valuable for exploring structure–activity relationships in PROTAC design and advancing targeted protein degradation strategies.
| CAS Number | 2225148-52-5 |
| Synonyms | tert-butyl 9-[2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindol-4-yl]oxynonanoate |
| Molecular Formula | C26H34N2O7 |
| Purity | ≥95% |
| IUPAC Name | tert-butyl 9-[2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindol-4-yl]oxynonanoate |
| InChI | InChI=1S/C26H34N2O7/c1-26(2,3)35-21(30)13-8-6-4-5-7-9-16-34-19-12-10-11-17-22(19)25(33)28(24(17)32)18-14-15-20(29)27-23(18)31/h10-12,18H,4-9,13-16H2,1-3H3,(H,27,29,31) |
| InChIKey | XHFRZVFJJQOBAQ-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)CCCCCCCCOC1=CC=CC2=C1C(=O)N(C2=O)C3CCC(=O)NC3=O |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |
