For research use only. Not for therapeutic Use.
Thalidomide-NH-PEG3-COOH(Cat N0.:I044490)is a multifunctional linker designed for constructing PROTACs and related targeted therapeutics. It incorporates a thalidomide moiety that binds to cereblon E3 ligase, an amide (NH) linkage ensuring stable attachment, and a PEG3 (triethylene glycol) spacer that enhances water solubility, reduces steric hindrance, and improves molecular flexibility. The terminal carboxylic acid group allows for efficient conjugation with amine-containing ligands or drug molecules. This extended, hydrophilic linker design enables optimal spatial orientation between ligase and target-binding domains, supporting the development of selective protein degraders in chemical biology and drug discovery applications.
| CAS Number | 2375283-62-6 |
| Synonyms | 3-[2-[2-[2-[[2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindol-5-yl]amino]ethoxy]ethoxy]ethoxy]propanoic acid |
| Molecular Formula | C22H27N3O9 |
| Purity | ≥95% |
| IUPAC Name | 3-[2-[2-[2-[[2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindol-5-yl]amino]ethoxy]ethoxy]ethoxy]propanoic acid |
| InChI | InChI=1S/C22H27N3O9/c26-18-4-3-17(20(29)24-18)25-21(30)15-2-1-14(13-16(15)22(25)31)23-6-8-33-10-12-34-11-9-32-7-5-19(27)28/h1-2,13,17,23H,3-12H2,(H,27,28)(H,24,26,29) |
| InChIKey | SYFPHSMLSPHFLO-UHFFFAOYSA-N |
| SMILES | C1CC(=O)NC(=O)C1N2C(=O)C3=C(C2=O)C=C(C=C3)NCCOCCOCCOCCC(=O)O |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |