For research use only. Not for therapeutic Use.
Thalidomide-NH-PEG2-COOH（Cat No.:I044489）is a bifunctional linker molecule designed for use in targeted protein degradation platforms such as PROTACs. It features a thalidomide moiety for cereblon E3 ligase recruitment, an amide-linked PEG2 (diethylene glycol) spacer for improved hydrophilicity and molecular flexibility, and a terminal carboxylic acid group for conjugation to amine-containing ligands or payloads. The NH linkage ensures stable attachment of the PEG spacer to the thalidomide core, while the PEG2 unit helps reduce steric hindrance and enhance solubility. This linker facilitates efficient and selective assembly of multifunctional therapeutic agents.
| CAS Number | 2412056-45-0 |
| Synonyms | 3-[2-[2-[[2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindol-5-yl]amino]ethoxy]ethoxy]propanoic acid |
| Molecular Formula | C20H23N3O8 |
| Purity | ≥95% |
| IUPAC Name | 3-[2-[2-[[2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindol-5-yl]amino]ethoxy]ethoxy]propanoic acid |
| InChI | InChI=1S/C20H23N3O8/c24-16-4-3-15(18(27)22-16)23-19(28)13-2-1-12(11-14(13)20(23)29)21-6-8-31-10-9-30-7-5-17(25)26/h1-2,11,15,21H,3-10H2,(H,25,26)(H,22,24,27) |
| InChIKey | TWTMAVHRHZISKR-UHFFFAOYSA-N |
| SMILES | C1CC(=O)NC(=O)C1N2C(=O)C3=C(C2=O)C=C(C=C3)NCCOCCOCCC(=O)O |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |
