For research use only. Not for therapeutic Use.
Thalidomide-5-PEG7-NH₂ hydrochloride(CAT: I040295) is a thalidomide (HY-10984)-based cereblon (CRBN) ligand featuring a heptaethylene glycol (PEG7) linker with a terminal amino group at the 5-position. This PEGylated design enhances solubility, flexibility, and pharmacokinetic properties, making it well-suited for PROTAC (proteolysis-targeting chimera) synthesis. The molecule enables efficient recruitment of the CRBN E3 ubiquitin ligase complex to a target protein, facilitating selective ubiquitination and degradation. The PEG7 spacer offers optimal linker length and hydrophilicity for diverse conjugation strategies.
| Synonyms | 5-[2-[2-[2-[2-[2-[2-(2-aminoethoxy)ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]-2-(2,6-dioxopiperidin-3-yl)isoindole-1,3-dione;hydrochloride |
| Molecular Formula | C27H40ClN3O11 |
| Purity | ≥95% |
| IUPAC Name | 5-[2-[2-[2-[2-[2-[2-(2-aminoethoxy)ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]-2-(2,6-dioxopiperidin-3-yl)isoindole-1,3-dione;hydrochloride |
| InChI | InChI=1S/C27H39N3O11.ClH/c28-5-6-35-7-8-36-9-10-37-11-12-38-13-14-39-15-16-40-17-18-41-20-1-2-21-22(19-20)27(34)30(26(21)33)23-3-4-24(31)29-25(23)32;/h1-2,19,23H,3-18,28H2,(H,29,31,32);1H |
| InChIKey | UPLYFPOURSUULH-UHFFFAOYSA-N |
| SMILES | C1CC(=O)NC(=O)C1N2C(=O)C3=C(C2=O)C=C(C=C3)OCCOCCOCCOCCOCCOCCOCCN.Cl |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |
