For research use only. Not for therapeutic Use.
Thalidomide-5-O-C9-NH₂ hydrochloride(CAT: I040318) is a thalidomide (HY-10984)-derived cereblon (CRBN) ligand, functionalized with a 9-carbon alkylamino linker at the 5-position. Designed for use in PROTAC (proteolysis-targeting chimera) development, it facilitates CRBN E3 ubiquitin ligase recruitment for targeted protein degradation. The C9 linker provides balanced flexibility and spatial orientation, allowing effective conjugation to various target ligands. This compound is supplied as a hydrochloride salt for enhanced solubility and stability, making it a valuable intermediate for the synthesis of custom protein degraders in oncology, immunology, and neurodegenerative research.
| Synonyms | 5-(9-aminononoxy)-2-(2,6-dioxopiperidin-3-yl)isoindole-1,3-dione;hydrochloride |
| Molecular Formula | C22H30ClN3O5 |
| Purity | ≥95% |
| IUPAC Name | 5-(9-aminononoxy)-2-(2,6-dioxopiperidin-3-yl)isoindole-1,3-dione;hydrochloride |
| InChI | InChI=1S/C22H29N3O5.ClH/c23-12-6-4-2-1-3-5-7-13-30-15-8-9-16-17(14-15)22(29)25(21(16)28)18-10-11-19(26)24-20(18)27;/h8-9,14,18H,1-7,10-13,23H2,(H,24,26,27);1H |
| InChIKey | BWTYZYUAWBSERA-UHFFFAOYSA-N |
| SMILES | C1CC(=O)NC(=O)C1N2C(=O)C3=C(C2=O)C=C(C=C3)OCCCCCCCCCN.Cl |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |
