For research use only. Not for therapeutic Use.
Thalidomide-5-O-C8-NH₂ hydrochloride(CAT: I040319) is a thalidomide (HY-10984)-based cereblon (CRBN) ligand featuring an 8-carbon alkylamino linker at the 5-position. It is designed for use in the synthesis of PROTACs (proteolysis-targeting chimeras), enabling selective recruitment of the CRBN E3 ubiquitin ligase to induce targeted protein degradation. The C8 linker length offers a balance between flexibility and spatial orientation, supporting efficient ternary complex formation when conjugated to diverse protein-targeting moieties. Supplied as a hydrochloride salt for improved solubility and chemical stability, Thalidomide-5-O-C8-NH₂ HCl is an essential building block for developing next-generation targeted therapies.
| Synonyms | 5-(8-aminooctoxy)-2-(2,6-dioxopiperidin-3-yl)isoindole-1,3-dione;hydrochloride |
| Molecular Formula | C21H28ClN3O5 |
| Purity | ≥95% |
| IUPAC Name | 5-(8-aminooctoxy)-2-(2,6-dioxopiperidin-3-yl)isoindole-1,3-dione;hydrochloride |
| InChI | InChI=1S/C21H27N3O5.ClH/c22-11-5-3-1-2-4-6-12-29-14-7-8-15-16(13-14)21(28)24(20(15)27)17-9-10-18(25)23-19(17)26;/h7-8,13,17H,1-6,9-12,22H2,(H,23,25,26);1H |
| InChIKey | BNPYNTUHLDGEBR-UHFFFAOYSA-N |
| SMILES | C1CC(=O)NC(=O)C1N2C(=O)C3=C(C2=O)C=C(C=C3)OCCCCCCCCN.Cl |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |
