For research use only. Not for therapeutic Use.
TFC 007(Cat No.:I011101)is a small molecule inhibitor that targets specific signaling pathways involved in cancer cell survival and proliferation. It works by inhibiting a key protein or enzyme that regulates cell cycle progression, thus disrupting the growth of cancer cells. TFC 007 has shown potential in preclinical studies, particularly in the treatment of solid tumors and hematological cancers. Its ability to modulate critical molecular targets makes it a promising candidate for combination therapies. However, further clinical trials are necessary to fully assess its safety, efficacy, and potential for widespread use in cancer treatment.
| CAS Number | 927878-49-7 |
| Synonyms | N-[4-[4-(morpholine-4-carbonyl)piperidin-1-yl]phenyl]-2-phenoxypyrimidine-5-carboxamide |
| Molecular Formula | C27H29N5O4 |
| Purity | ≥95% |
| IUPAC Name | N-[4-[4-(morpholine-4-carbonyl)piperidin-1-yl]phenyl]-2-phenoxypyrimidine-5-carboxamide |
| InChI | InChI=1S/C27H29N5O4/c33-25(21-18-28-27(29-19-21)36-24-4-2-1-3-5-24)30-22-6-8-23(9-7-22)31-12-10-20(11-13-31)26(34)32-14-16-35-17-15-32/h1-9,18-20H,10-17H2,(H,30,33) |
| InChIKey | NLSSUSRERAMBTA-UHFFFAOYSA-N |
| SMILES | C1CN(CCC1C(=O)N2CCOCC2)C3=CC=C(C=C3)NC(=O)C4=CN=C(N=C4)OC5=CC=CC=C5 |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |