For research use only. Not for therapeutic Use.
Texasin（Cat No.:I012176）is an investigational compound being developed for its potential in treating autoimmune diseases and inflammatory conditions. It works by modulating immune cell activity and inhibiting the production of pro-inflammatory cytokines that contribute to tissue damage in diseases such as rheumatoid arthritis, lupus, and multiple sclerosis. Texasin aims to selectively target specific pathways involved in immune regulation, reducing excessive inflammation without broadly suppressing the immune system. Early preclinical studies have shown promising results, and ongoing clinical trials are evaluating its safety, efficacy, and potential as a novel therapeutic for inflammatory disorders.
| CAS Number | 897-46-1 |
| Synonyms | 6,7-dihydroxy-3-(4-methoxyphenyl)chromen-4-one |
| Molecular Formula | C16H12O5 |
| Purity | ≥95% |
| IUPAC Name | 6,7-dihydroxy-3-(4-methoxyphenyl)chromen-4-one |
| InChI | InChI=1S/C16H12O5/c1-20-10-4-2-9(3-5-10)12-8-21-15-7-14(18)13(17)6-11(15)16(12)19/h2-8,17-18H,1H3 |
| InChIKey | GCWOYVFHJDNKIN-UHFFFAOYSA-N |
| SMILES | COC1=CC=C(C=C1)C2=COC3=CC(=C(C=C3C2=O)O)O |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |
