For research use only. Not for therapeutic Use.
Tetraphenylgermane(CAT: M070830) is an organogermanium compound with the formula Ge(C₆H₅)₄, consisting of a central germanium atom bonded to four phenyl groups. This crystalline solid is widely used in organometallic and materials chemistry as a precursor for the synthesis of germanium-containing polymers, coordination complexes, and hybrid materials. Its rigid tetrahedral geometry and aromatic substituents provide thermal stability and structural definition, making it useful in studying bonding and reactivity in main-group chemistry. Tetraphenylgermane also serves as a model compound for investigating organogermanium pharmacophores and functional materials.
| CAS Number | 1048-05-1 |
| Molecular Formula | (C6H5)4Ge |
| Purity | ≥95% |
| Storage | -20°C |
| IUPAC Name | tetraphenylgermane |
| InChI | InChI=1S/C24H20Ge/c1-5-13-21(14-6-1)25(22-15-7-2-8-16-22,23-17-9-3-10-18-23)24-19-11-4-12-20-24/h1-20H |
| InChIKey | ILEXMONMGUVLRM-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)[Ge](C2=CC=CC=C2)(C3=CC=CC=C3)C4=CC=CC=C4 |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |
