For research use only. Not for therapeutic Use.
Tetrakis(2-propynyloxymethyl)methane(Cat No.:M126648) is a chemical compound with four 2-propynyloxymethyl groups attached to a central methane carbon atom. It is commonly used as a crosslinking agent in polymer chemistry, particularly in the synthesis of polyurethanes and epoxy resins. The presence of multiple alkyne groups in tetrakis(2-propynyloxymethyl)methane allows for the formation of strong covalent bonds with other molecules, leading to the formation of crosslinked polymer networks. These networks exhibit improved mechanical properties, such as increased strength and toughness, making tetrakis(2-propynyloxymethyl)methane a valuable component in the production of advanced materials with tailored properties for various applications.
CAS Number | 127751-08-0 |
Molecular Formula | C17H20O4 |
Purity | ≥95% |
Storage | -20°C |
IUPAC Name | 1,3-bis(prop-2-ynoxy)-2,2-bis(prop-2-ynoxymethyl)propane |
InChI | InChI=1S/C17H20O4/c1-5-9-18-13-17(14-19-10-6-2,15-20-11-7-3)16-21-12-8-4/h1-4H,9-16H2 |
InChIKey | PBIYZQCDULGYAW-UHFFFAOYSA-N |
SMILES | C#CCOCC(COCC#C)(COCC#C)COCC#C |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |