For research use only. Not for therapeutic Use.
Tetrahydrofurfuryl acrylate (Cat No.:L045147) is an acrylate ester formed by the reaction of acrylic acid with tetrahydrofurfuryl alcohol. It features a reactive acrylate group and a tetrahydrofuran ring, offering both hydrophilic and hydrophobic characteristics. THFA is widely used in UV-curable coatings, adhesives, and polymer formulations due to its excellent adhesion, flexibility, and chemical resistance. The acrylate moiety allows for rapid free-radical polymerization, while the tetrahydrofuran ring imparts improved solvent resistance and mechanical strength. THFA is valued in high-performance materials for electronics, automotive, and industrial applications.
| CAS Number | 2399-48-6 |
| Molecular Formula | C8H12O3 |
| Purity | ≥95% |
| IUPAC Name | oxolan-2-ylmethyl prop-2-enoate |
| InChI | InChI=1S/C8H12O3/c1-2-8(9)11-6-7-4-3-5-10-7/h2,7H,1,3-6H2 |
| InChIKey | YNXCGLKMOXLBOD-UHFFFAOYSA-N |
| SMILES | C=CC(=O)OCC1CCCO1 |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |
