Tetrahydrodicyclopentadiene (Cat No.:C001079) is a chemical compound with a bicyclic structure composed of two cyclopentadiene rings fused. It is a colorless liquid and a key intermediate in the synthesis of various chemicals, including resins, plastics, and synthetic rubber. Tetrahydrodicyclopentadiene is used as a monomer in the production of dicyclopentadiene-based polymers, which find applications in the coatings, adhesives, and automotive industries.
| Catalog Number | C001079 |
| CAS Number | 6004-38-2 |
| Synonyms | Octahydro-4,7-methano-1H-indene; 2,3-Trimethylenenorbornane; 2,3-(1,3-Propanediyl)bicyclo[2.2.1]heptane; Hexahydro-4,7-methanoindan;NSC 22464;Tetrahydrocyclopentadiene dimer; Tricyclo[5.2.1.02,6]decane;Trimethylenenorbornane |
| Molecular Formula | C₁₀H₁₆ |
| Purity | ≥95% |
| Solubility | Chloroform (Sparingly), DMSO (Slightly) |
| Appearance | Off-White Sticky Solid to Waxy Solid |
| Storage | 2-8°C |
| IUPAC Name | tricyclo[5.2.1.02,6]decane |
| InChI | InChI=1S/C10H16/c1-2-9-7-4-5-8(6-7)10(9)3-1/h7-10H,1-6H2 |
| InChIKey | LPSXSORODABQKT-UHFFFAOYSA-N |
| SMILES | C1CC2C3CCC(C3)C2C1 |
| Reference | Howard, Philip H., et al.; Environ. Sci. Technol., 44,В 2277 (2010); Grosjean, Eric., et al.: Atmos. Environ., 32,В 3371(1998) |
