For research use only. Not for therapeutic Use.
Tetragastrin（Cat No.:M123271）is a synthetic peptide composed of the four C-terminal amino acids of gastrin, the gastrointestinal hormone responsible for stimulating gastric acid secretion. It retains the biological activity of natural gastrin, making it a valuable tool in clinical diagnostics and research. Tetragastrin is commonly used to assess gastric acid secretory function and to stimulate gastric mucosa in diagnostic tests for conditions like Zollinger-Ellison syndrome or atrophic gastritis. Its ability to mimic gastrin activity also makes it useful in studying gastric physiology, gastrointestinal hormone regulation, and related pharmacological interventions.
| CAS Number | 1947-37-1 |
| Synonyms | (3S)-3-[[(2S)-2-[[(2S)-2-amino-3-(1H-indol-3-yl)propanoyl]amino]-4-methylsulfanylbutanoyl]amino]-4-[[(2S)-1-amino-1-oxo-3-phenylpropan-2-yl]amino]-4-oxobutanoic acid |
| Molecular Formula | C29H36N6O6S |
| Purity | ≥95% |
| IUPAC Name | (3S)-3-[[(2S)-2-[[(2S)-2-amino-3-(1H-indol-3-yl)propanoyl]amino]-4-methylsulfanylbutanoyl]amino]-4-[[(2S)-1-amino-1-oxo-3-phenylpropan-2-yl]amino]-4-oxobutanoic acid |
| InChI | InChI=1S/C29H36N6O6S/c1-42-12-11-22(33-27(39)20(30)14-18-16-32-21-10-6-5-9-19(18)21)28(40)35-24(15-25(36)37)29(41)34-23(26(31)38)13-17-7-3-2-4-8-17/h2-10,16,20,22-24,32H,11-15,30H2,1H3,(H2,31,38)(H,33,39)(H,34,41)(H,35,40)(H,36,37)/t20-,22-,23-,24-/m0/s1 |
| InChIKey | RGYLYUZOGHTBRF-BIHRQFPBSA-N |
| SMILES | CSCC[C@@H](C(=O)N[C@@H](CC(=O)O)C(=O)N[C@@H](CC1=CC=CC=C1)C(=O)N)NC(=O)[C@H](CC2=CNC3=CC=CC=C32)N |
| Reference |
|
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |
