For research use only. Not for therapeutic Use.
Tetraethylammonium hexafluorophosphate(Cat No.:L006929), is a quaternary ammonium salt. This compound consists of a tetraethylammonium cation (C2H5)4N⁺ and a hexafluorophosphate anion (PF6⁻). It is widely used as an electrolyte and supporting electrolyte in electrochemical applications, such as batteries and supercapacitors. Tetraethylammonium hexafluorophosphate enhances ionic conductivity and stability in these systems. Its compatibility with various solvents and stability at high potentials make it valuable in electrochemistry research. The compound’s properties facilitate the development of advanced energy storage devices, contributing significantly to the field of electrochemical technology.
| CAS Number | 429-07-2 |
| Molecular Formula | C8H20F6NP |
| Purity | ≥95% |
| IUPAC Name | tetraethylazanium;hexafluorophosphate |
| InChI | InChI=1S/C8H20N.F6P/c1-5-9(6-2,7-3)8-4;1-7(2,3,4,5)6/h5-8H2,1-4H3;/q+1;-1 |
| InChIKey | KLKUOIXSIDDDCN-UHFFFAOYSA-N |
| SMILES | CC[N+](CC)(CC)CC.F[P-](F)(F)(F)(F)F |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |