TETRAETHYLAMMONIUM BENZOATE - CAS 16909-22-1

Tetraethylammonium Benzoate (CAT: M078345) is a quaternary ammonium salt employed in organic synthesis as a phase-transfer catalyst, enabling the transfer of reactants between aqueous and organic phases in otherwise immiscible reactions. This characteristic proves particularly valuable in the synthesis of various organic compounds, enhancing reaction efficiency. Additionally, it finds use in analytical chemistry as a reference standard or reagent for specific tests, contributing to accurate chemical analyses.

Catalog Number: M078345

CAS Number: 16909-22-1

PubChem Substance ID:355429200

Molecular Formula: C15H25NO2

Molecular Weight:251.37

Purity: ≥95%

* For research use only. Not for human or veterinary use.


Property

Molecular Formula: C15H25NO2
Molecular Weight251.37
Purity≥95%
Storage-20°C

Computed Descriptor

IUPAC Nametetraethylazanium;benzoate
InChIInChI=1S/C8H20N.C7H6O2/c1-5-9(6-2,7-3)8-4;8-7(9)6-4-2-1-3-5-6/h5-8H2,1-4H3;1-5H,(H,8,9)/q+1;/p-1
InChIKeyCIFIGXMZHITUAZ-UHFFFAOYSA-M
SMILESCC[N+](CC)(CC)CC.C1=CC=C(C=C1)C(=O)[O-]