For research use only. Not for therapeutic Use.
Tetrabutylstannane-d36(Cat No.:R015487) is a heavily deuterated version of Tetrabutylstannane, where all thirty-six hydrogen atoms in the butyl groups are replaced with deuterium. This isotopic substitution significantly enhances its stability, making it a valuable tool for chemical synthesis and mechanistic studies involving organotin compounds. Tetrabutylstannane-d36 is particularly useful in NMR spectroscopy, where its deuterated form provides clearer signals and more accurate structural information. The compound is crucial for researching the catalytic roles and reactivity of organotin derivatives in organic transformations, aiding in the development of new synthetic routes and materials with organotin-based catalysts.
CAS Number | 358731-92-7 |
Synonyms | Tetra(butyl-d9)stannane; |
Molecular Formula | C16H36Sn |
Purity | ≥95% |
Storage | Room temperature |
IUPAC Name | tetrakis(1,1,2,2,3,3,4,4,4-nonadeuteriobutyl)stannane |
InChI | InChI=1S/4C4H9.Sn/c4*1-3-4-2;/h4*1,3-4H2,2H3;/i4*1D2,2D3,3D2,4D2; |
InChIKey | AFCAKJKUYFLYFK-RELSAODYSA-N |
SMILES | [2H]C([2H])([2H])C([2H])([2H])C([2H])([2H])C([2H])([2H])[Sn](C([2H])([2H])C([2H])([2H])C([2H])([2H])C([2H])([2H])[2H])(C([2H])([2H])C([2H])([2H])C([2H])([2H])C([2H])([2H])[2H])C([2H])([2H])C([2H])([2H])C([2H])([2H])C([2H])([2H])[2H] |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |