Tetraacetylethylenediamine (Cat.No:M063053) is a versatile chemical compound commonly used as a bleach activator in laundry detergents. It enhances the bleaching effectiveness of hydrogen peroxide by generating peroxyacetic acid. This compound finds extensive application in household and industrial laundry processes for efficient stain removal and fabric brightening.
| Catalog Number | M063053 |
| CAS Number | 10543-57-4 |
| Molecular Formula | C10H16N2O4 |
| Purity | 95% |
| Storage | Store at -20°C |
| IUPAC Name | N-acetyl-N-[2-(diacetylamino)ethyl]acetamide |
| InChI | InChI=1S/C10H16N2O4/c1-7(13)11(8(2)14)5-6-12(9(3)15)10(4)16/h5-6H2,1-4H3 |
| InChIKey | BGRWYDHXPHLNKA-UHFFFAOYSA-N |
| SMILES | CC(=O)N(CCN(C(=O)C)C(=O)C)C(=O)C |
