Tetra(ethylene glycol) diacrylate (Cat No.:M082461) is a bifunctional acrylate ester formed by the acrylation of tetra(ethylene glycol). It is a low-viscosity, colorless liquid used primarily as a crosslinking agent in polymer chemistry. TEGDA is particularly valuable in the synthesis of polymeric materials due to its ability to form highly flexible and hydrophilic networks. This makes it ideal for applications in hydrogels, adhesives, coatings, and dental composites. Its properties enhance the mechanical strength and durability of polymers while maintaining their elasticity and improving resistance to water and other solvents.
Catalog Number | M082461 |
CAS Number | 17831-71-9 |
Molecular Formula | C14H22O7 |
Purity | ≥95% |
Storage | Store at -20°C |
IUPAC Name | 2-[2-[2-(2-prop-2-enoyloxyethoxy)ethoxy]ethoxy]ethyl prop-2-enoate |
InChI | InChI=1S/C14H22O7/c1-3-13(15)20-11-9-18-7-5-17-6-8-19-10-12-21-14(16)4-2/h3-4H,1-2,5-12H2 |
InChIKey | HCLJOFJIQIJXHS-UHFFFAOYSA-N |
SMILES | C=CC(=O)OCCOCCOCCOCCOC(=O)C=C |