For research use only. Not for therapeutic Use.
Tesofensine（Cat No.:R023264）is a potent triple monoamine reuptake inhibitor that blocks the transporters for serotonin, norepinephrine, and dopamine, leading to increased neurotransmitter levels in the brain. Originally investigated for neurodegenerative diseases such as Alzheimer’s and Parkinson’s, it was later repurposed for obesity treatment due to its appetite-suppressing effects. Tesofensine reduces food intake and promotes weight loss while potentially enhancing mood and cognitive function. It is a valuable research tool for studying neurotransmitter regulation, appetite control, and metabolic disorders, with therapeutic potential in obesity management and related metabolic health interventions.
| CAS Number | 195875-84-4 |
| Synonyms | (1R,2R,3S,5S)-3-(3,4-dichlorophenyl)-2-(ethoxymethyl)-8-methyl-8-azabicyclo[3.2.1]octane |
| Molecular Formula | C17H23Cl2NO |
| Purity | ≥95% |
| IUPAC Name | (1R,2R,3S,5S)-3-(3,4-dichlorophenyl)-2-(ethoxymethyl)-8-methyl-8-azabicyclo[3.2.1]octane |
| InChI | InChI=1S/C17H23Cl2NO/c1-3-21-10-14-13(9-12-5-7-17(14)20(12)2)11-4-6-15(18)16(19)8-11/h4,6,8,12-14,17H,3,5,7,9-10H2,1-2H3/t12-,13+,14+,17+/m0/s1 |
| InChIKey | VCVWXKKWDOJNIT-ZOMKSWQUSA-N |
| SMILES | CCOC[C@H]1[C@H]2CC[C@H](N2C)C[C@@H]1C3=CC(=C(C=C3)Cl)Cl |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |
