For research use only. Not for therapeutic Use.
tert-Butyl 2-(4-amino-2-fluorophenyl)acetate(Cat No.:L007481), is a chemical compound with significance in medicinal and synthetic chemistry. This compound consists of a tert-butyl ester group attached to a phenyl ring substituted with both an amino and a fluorine atom. Researchers utilize it as a valuable building block in the synthesis of various pharmaceutical agents and biologically active molecules. Its unique structure provides opportunities for the development of new drugs and compounds with specific biological activities.
CAS Number | 1239895-42-1 |
Molecular Formula | C12H16FNO2 |
Purity | ≥95% |
IUPAC Name | tert-butyl 2-(4-amino-2-fluorophenyl)acetate |
InChI | InChI=1S/C12H16FNO2/c1-12(2,3)16-11(15)6-8-4-5-9(14)7-10(8)13/h4-5,7H,6,14H2,1-3H3 |
InChIKey | IADQXUVPHZSPLH-UHFFFAOYSA-N |
SMILES | CC(C)(C)OC(=O)CC1=C(C=C(C=C1)N)F |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |