Home
>
Chemical Reagents>Heterocyclic Building Blocks> Tert-butyl 1,4,5,7-tetrahydro-6H-pyrrolo[2,3-C]pyridine-6-carboxylate
For research use only. Not for therapeutic Use.
Tert-butyl 1,4,5,7-tetrahydro-6H-pyrrolo[2,3-c]pyridine-6-carboxylate(Cat No.:L007182), is a chemical compound. It features a tetrahydropyrrolopyridine ring—a fused bicyclic structure—substituted with a tert-butyl ester group at the 6th position. This compound is significant in organic synthesis and medicinal chemistry research, often employed as an intermediate for the synthesis of diverse biologically active molecules and potential pharmaceuticals. Its unique structure offers opportunities for designing novel compounds, contributing to drug discovery efforts, and development specialized organic molecules for various therapeutic applications.
| CAS Number | 1393570-64-3 |
| Molecular Formula | C12H18N2O2 |
| Purity | ≥95% |
| IUPAC Name | tert-butyl 1,4,5,7-tetrahydropyrrolo[2,3-c]pyridine-6-carboxylate |
| InChI | InChI=1S/C12H18N2O2/c1-12(2,3)16-11(15)14-7-5-9-4-6-13-10(9)8-14/h4,6,13H,5,7-8H2,1-3H3 |
| InChIKey | FCMLLOZWHYDZAH-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1CCC2=C(C1)NC=C2 |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |