For research use only. Not for therapeutic Use.
Teriflunomide Impurity 3（Cat No.:I044545）is a known degradation product or synthetic byproduct associated with the manufacturing of teriflunomide, an immunomodulatory drug used to treat relapsing forms of multiple sclerosis. Identifying and quantifying this impurity is critical for ensuring the safety, efficacy, and regulatory compliance of the final pharmaceutical product. Analytical methods such as HPLC and mass spectrometry are typically used to detect and monitor this impurity during quality control. Studying Teriflunomide Impurity 3 also aids in understanding the drug’s stability profile and optimizing storage and formulation conditions.
| CAS Number | 1011244-72-6 |
| Synonyms | 4-amino-N-[4-(trifluoromethyl)phenyl]benzamide |
| Molecular Formula | C14H11F3N2O |
| Purity | ≥95% |
| IUPAC Name | 4-amino-N-[4-(trifluoromethyl)phenyl]benzamide |
| InChI | InChI=1S/C14H11F3N2O/c15-14(16,17)10-3-7-12(8-4-10)19-13(20)9-1-5-11(18)6-2-9/h1-8H,18H2,(H,19,20) |
| InChIKey | YUWBBWHECQSIKL-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C(=O)NC2=CC=C(C=C2)C(F)(F)F)N |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |
