For research use only. Not for therapeutic Use.
Terevalefim (Cat No.:I044671) is an investigational monoclonal antibody targeting B7-H3 (CD276), an immune checkpoint molecule overexpressed in various solid tumors. By blocking B7-H3, terevalefim aims to enhance T-cell–mediated anti-tumor immunity while minimizing immune suppression within the tumor microenvironment. It is being evaluated for its potential to improve immune response in cancers resistant to other checkpoint inhibitors. Terevalefim is currently in clinical development, often in combination with agents like anti–PD-1 antibodies, positioning it as a promising strategy for next-generation immuno-oncology therapies.
| CAS Number | 1070881-42-3 |
| Synonyms | 5-[(E)-2-thiophen-2-ylethenyl]-1H-pyrazole |
| Molecular Formula | C9H8N2S |
| Purity | ≥95% |
| IUPAC Name | 5-[(E)-2-thiophen-2-ylethenyl]-1H-pyrazole |
| InChI | InChI=1S/C9H8N2S/c1-2-9(12-7-1)4-3-8-5-6-10-11-8/h1-7H,(H,10,11)/b4-3+ |
| InChIKey | FOHWAQGURRYJFK-ONEGZZNKSA-N |
| SMILES | C1=CSC(=C1)/C=C/C2=CC=NN2 |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |
