For research use only. Not for therapeutic Use.
Tephrosin(CAT: R064449) is a naturally occurring rotenoid found in several plant species, particularly within the Tephrosia genus. This bioactive compound is known for its insecticidal and pesticidal properties, making it useful in agricultural applications. In addition to its role in pest control, Tephrosin exhibits a variety of pharmacological effects, including antitumor, anti-inflammatory, and antioxidant activities. Studies have shown that Tephrosin can induce apoptosis in cancer cells and inhibit inflammatory responses through the modulation of key cellular pathways, such as the NF-κB signaling pathway. Its potential as a therapeutic agent is being explored in the context of cancer treatment and inflammation control, underscoring its value in biomedical research.
| CAS Number | 76-80-2 |
| Synonyms | Deguelinol I;Hydroxydeguelin |
| Molecular Formula | C23H22O7 |
| Purity | ≥95% |
| Target | Protein Tyrosine Kinase/RTK |
| Storage | -20°C |
| InChI | InChI=1S/C23H22O7/c1-22(2)8-7-12-15(30-22)6-5-13-20(12)29-19-11-28-16-10-18(27-4)17(26-3)9-14(16)23(19,25)21(13)24/h5-10,19,25H,11H2,1-4H3/t19-,23-/m1/s1 |
| InChIKey | AQBZCCQCDWNNJQ-AUSIDOKSSA-N |
| SMILES | CC1(C=CC2=C(O1)C=CC3=C2OC4COC5=CC(=C(C=C5C4(C3=O)O)OC)OC)C |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |